C24H39NO6S — CID 57313963
5-[(2R,3aR,4R,5R,6aS)-5-hydroxy-4-[(3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-N-propan-2-ylsulfonylpentanamide (PubChem CID 57313963) has the molecular formula C24H39NO6S and a molecular weight of 469.64 g/mol. Its IUPAC name is 5-[(2R,3aR,4R,5R,6aS)-5-hydroxy-4-[(3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-N-propan-2-ylsulfonylpentanamide.
| Compound Name | 5-[(2R,3aR,4R,5R,6aS)-5-hydroxy-4-[(3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-N-propan-2-ylsulfonylpentanamide |
|---|---|
| PubChem CID | 57313963 |
| Molecular Formula | C24H39NO6S |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 5-[(2R,3aR,4R,5R,6aS)-5-hydroxy-4-[(3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-N-propan-2-ylsulfonylpentanamide |
| SMILES | CC#CCC(C)[C@H](O)C=C[C@@H]1[C@H]2C[C@@H](CCCCC(=O)NS(=O)(=O)C(C)C)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C24H39NO6S/c1-5-6-9-17(4)21(26)13-12-19-20-14-18(31-23(20)15-22(19)27)10-7-8-11-24(28)25-32(29,30)16(2)3/h12-13,16-23,26-27H,7-11,14-15H2,1-4H3,(H,25,28)/t17?,18-,19-,20-,21-,22-,23+/m1/s1 |
| InChIKey | SDXSWURUHGJWRC-WPUOFKJMSA-N |
| XLogP | 2.52 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|