C25H41NO6S — CID 22810219
5-[(2R,3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-N-propan-2-ylsulfonylpentanamide (PubChem CID 22810219) has the molecular formula C25H41NO6S and a molecular weight of 483.67 g/mol. Its IUPAC name is 5-[(2R,3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-N-propan-2-ylsulfonylpentanamide.
| Compound Name | 5-[(2R,3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-N-propan-2-ylsulfonylpentanamide |
|---|---|
| PubChem CID | 22810219 |
| Molecular Formula | C25H41NO6S |
| Molecular Weight | 483.67 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 5-[(2R,3aR,4R,5R,6aS)-5-hydroxy-4-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-N-propan-2-ylsulfonylpentanamide |
| SMILES | CC#CCC(C)(C)[C@H](O)/C=C/[C@@H]1[C@H]2C[C@@H](CCCCC(=O)NS(=O)(=O)C(C)C)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H41NO6S/c1-6-7-14-25(4,5)23(28)13-12-19-20-15-18(32-22(20)16-21(19)27)10-8-9-11-24(29)26-33(30,31)17(2)3/h12-13,17-23,27-28H,8-11,14-16H2,1-5H3,(H,26,29)/b13-12+/t18-,19-,20-,21-,22+,23-/m1/s1 |
| InChIKey | WKVZANLLCGDDPP-PLVUFHDJSA-N |
| XLogP | 2.91 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.67 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|