C24H42O4 — CID 57316596
5-[(2S,3aR,4S,5R,6aS)-5-methyl-4-[(3R)-3,4,4-trimethyloct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentaneperoxoic acid (PubChem CID 57316596) has the molecular formula C24H42O4 and a molecular weight of 394.60 g/mol. Its IUPAC name is 5-[(2S,3aR,4S,5R,6aS)-5-methyl-4-[(3R)-3,4,4-trimethyloct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentaneperoxoic acid.
| Compound Name | 5-[(2S,3aR,4S,5R,6aS)-5-methyl-4-[(3R)-3,4,4-trimethyloct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentaneperoxoic acid |
|---|---|
| PubChem CID | 57316596 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | 5-[(2S,3aR,4S,5R,6aS)-5-methyl-4-[(3R)-3,4,4-trimethyloct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentaneperoxoic acid |
| SMILES | CCCCC(C)(C)[C@H](C)C=C[C@H]1[C@H]2C[C@H](CCCCC(=O)OO)O[C@H]2C[C@H]1C |
| InChI | InChI=1S/C24H42O4/c1-6-7-14-24(4,5)18(3)12-13-20-17(2)15-22-21(20)16-19(27-22)10-8-9-11-23(25)28-26/h12-13,17-22,26H,6-11,14-16H2,1-5H3/t17-,18-,19+,20-,21-,22+/m1/s1 |
| InChIKey | SXCUJUWBMGQRGO-MCSHHISBSA-N |
| XLogP | 6.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|