C25H40O6 — CID 22810204
methyl 5-[(2S,3aR,4R,6aS)-5-acetyloxy-4-[(1E)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoate (PubChem CID 22810204) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is methyl 5-[(2S,3aR,4R,6aS)-5-acetyloxy-4-[(1E)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoate.
| Compound Name | methyl 5-[(2S,3aR,4R,6aS)-5-acetyloxy-4-[(1E)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoate |
|---|---|
| PubChem CID | 22810204 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | methyl 5-[(2S,3aR,4R,6aS)-5-acetyloxy-4-[(1E)-3-hydroxy-3,7-dimethylocta-1,6-dienyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]pentanoate |
| SMILES | COC(=O)CCCC[C@H]1C[C@H]2[C@H](CC(OC(C)=O)[C@@H]2/C=C/C(C)(O)CCC=C(C)C)O1 |
| InChI | InChI=1S/C25H40O6/c1-17(2)9-8-13-25(4,28)14-12-20-21-15-19(10-6-7-11-24(27)29-5)31-23(21)16-22(20)30-18(3)26/h9,12,14,19-23,28H,6-8,10-11,13,15-16H2,1-5H3/b14-12+/t19-,20+,21+,22?,23-,25?/m0/s1 |
| InChIKey | GAVHEKKTHKQZSS-JBUWXGHNSA-N |
| XLogP | 4.50 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|