C20H31IO5 — CID 56978828
8-[(2R,3aR,4S,5S,6aR)-5-acetyloxy-2-(iodomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]oct-7-enyl acetate (PubChem CID 56978828) has the molecular formula C20H31IO5 and a molecular weight of 478.37 g/mol. Its IUPAC name is 8-[(2R,3aR,4S,5S,6aR)-5-acetyloxy-2-(iodomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]oct-7-enyl acetate.
| Compound Name | 8-[(2R,3aR,4S,5S,6aR)-5-acetyloxy-2-(iodomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]oct-7-enyl acetate |
|---|---|
| PubChem CID | 56978828 |
| Molecular Formula | C20H31IO5 |
| Molecular Weight | 478.37 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 8-[(2R,3aR,4S,5S,6aR)-5-acetyloxy-2-(iodomethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]oct-7-enyl acetate |
| SMILES | CC(=O)OCCCCCCC=C[C@H]1[C@H]2C[C@H](CI)O[C@@H]2C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H31IO5/c1-14(22)24-10-8-6-4-3-5-7-9-17-18-11-16(13-21)26-20(18)12-19(17)25-15(2)23/h7,9,16-20H,3-6,8,10-13H2,1-2H3/t16-,17+,18-,19+,20-/m1/s1 |
| InChIKey | MLTOJLLVIXYFJA-UJMXGEILSA-N |
| XLogP | 4.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|