C15H24O5 — CID 56990025
7-[(1S,2R,5R)-2-(1,3-dioxolan-2-yl)-5-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 56990025) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is 7-[(1S,2R,5R)-2-(1,3-dioxolan-2-yl)-5-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2R,5R)-2-(1,3-dioxolan-2-yl)-5-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 56990025 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 7-[(1S,2R,5R)-2-(1,3-dioxolan-2-yl)-5-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@H](O)CC[C@H]1C1OCCO1 |
| InChI | InChI=1S/C15H24O5/c16-13-8-7-12(15-19-9-10-20-15)11(13)5-3-1-2-4-6-14(17)18/h1,3,11-13,15-16H,2,4-10H2,(H,17,18)/t11-,12+,13+/m0/s1 |
| InChIKey | REIPMPYIEADOFM-YNEHKIRRSA-N |
| XLogP | 1.95 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|