C24H36BrNO4S — CID 91023068
7-[(1R,2R)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]-N-(2-hydroxyethyl)hept-5-enamide (PubChem CID 91023068) has the molecular formula C24H36BrNO4S and a molecular weight of 514.53 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]-N-(2-hydroxyethyl)hept-5-enamide.
| Compound Name | 7-[(1R,2R)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]-N-(2-hydroxyethyl)hept-5-enamide |
|---|---|
| PubChem CID | 91023068 |
| Molecular Formula | C24H36BrNO4S |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 7-[(1R,2R)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]-N-(2-hydroxyethyl)hept-5-enamide |
| SMILES | Cc1sc(CC[C@H](O)C=C[C@H]2CCC(O)[C@@H]2CC=CCCCC(=O)NCCO)cc1Br |
| InChI | InChI=1S/C24H36BrNO4S/c1-17-22(25)16-20(31-17)12-11-19(28)10-8-18-9-13-23(29)21(18)6-4-2-3-5-7-24(30)26-14-15-27/h2,4,8,10,16,18-19,21,23,27-29H,3,5-7,9,11-15H2,1H3,(H,26,30)/t18-,19+,21+,23?/m0/s1 |
| InChIKey | SGFXSUBMWNCYGY-WTEKZAPDSA-N |
| XLogP | 4.28 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|