C9H11BrO3S — CID 102828899
2-[2-(4-bromo-5-methylthiophen-2-yl)ethoxy]acetic acid (PubChem CID 102828899) has the molecular formula C9H11BrO3S and a molecular weight of 279.16 g/mol. Its IUPAC name is 2-[2-(4-bromo-5-methylthiophen-2-yl)ethoxy]acetic acid.
| Compound Name | 2-[2-(4-bromo-5-methylthiophen-2-yl)ethoxy]acetic acid |
|---|---|
| PubChem CID | 102828899 |
| Molecular Formula | C9H11BrO3S |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | 2-[2-(4-bromo-5-methylthiophen-2-yl)ethoxy]acetic acid |
| SMILES | Cc1sc(CCOCC(=O)O)cc1Br |
| InChI | InChI=1S/C9H11BrO3S/c1-6-8(10)4-7(14-6)2-3-13-5-9(11)12/h4H,2-3,5H2,1H3,(H,11,12) |
| InChIKey | NFEUSJZRWYUWJR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|