C29H45BrO4SSi — CID 67092649
methyl (Z)-7-[(1R,2R)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-5-oxocyclopentyl]hept-5-enoate (PubChem CID 67092649) has the molecular formula C29H45BrO4SSi and a molecular weight of 597.73 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 67092649 |
| Molecular Formula | C29H45BrO4SSi |
| Molecular Weight | 597.73 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | methyl (Z)-7-[(1R,2R)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-5-oxocyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1C(=O)CC[C@@H]1/C=C/[C@H](CCc1cc(Br)c(C)s1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H45BrO4SSi/c1-21-26(30)20-24(35-21)18-17-23(34-36(6,7)29(2,3)4)16-14-22-15-19-27(31)25(22)12-10-8-9-11-13-28(32)33-5/h8,10,14,16,20,22-23,25H,9,11-13,15,17-19H2,1-7H3/b10-8-,16-14+/t22-,23+,25+/m0/s1 |
| InChIKey | LFYKGVOELGALLX-LWZFOYMNSA-N |
| XLogP | 8.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.73 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|