C28H51NO8S — CID 159416044
(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-ethyl-N-methylsulfonylhept-5-enamide;2,2-dimethylpropanoic acid (PubChem CID 159416044) has the molecular formula C28H51NO8S and a molecular weight of 561.78 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-ethyl-N-methylsulfonylhept-5-enamide;2,2-dimethylpropanoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-ethyl-N-methylsulfonylhept-5-enamide;2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 159416044 |
| Molecular Formula | C28H51NO8S |
| Molecular Weight | 561.78 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]-N-ethyl-N-methylsulfonylhept-5-enamide;2,2-dimethylpropanoic acid |
| SMILES | CC(C)(C)C(=O)O.CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)N(CC)S(C)(=O)=O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C23H41NO6S.C5H10O2/c1-4-6-9-12-18(25)15-16-20-19(21(26)17-22(20)27)13-10-7-8-11-14-23(28)24(5-2)31(3,29)30;1-5(2,3)4(6)7/h7,10,15-16,18-22,25-27H,4-6,8-9,11-14,17H2,1-3H3;1-3H3,(H,6,7)/b10-7-,16-15+;/t18-,19+,20+,21-,22+;/m0./s1 |
| InChIKey | LPEDHQOPBMUSCI-ROQXOGRASA-N |
| XLogP | 3.88 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.78 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|