C25H40ClNO6S2 — CID 142201808
(1R,3R,4S)-4-[(E,3S)-5-(4-chloro-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]cyclopentane-1,3-diol;(Z)-N-ethylsulfonyloct-5-enamide (PubChem CID 142201808) has the molecular formula C25H40ClNO6S2 and a molecular weight of 550.18 g/mol. Its IUPAC name is (1R,3R,4S)-4-[(E,3S)-5-(4-chloro-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]cyclopentane-1,3-diol;(Z)-N-ethylsulfonyloct-5-enamide.
| Compound Name | (1R,3R,4S)-4-[(E,3S)-5-(4-chloro-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]cyclopentane-1,3-diol;(Z)-N-ethylsulfonyloct-5-enamide |
|---|---|
| PubChem CID | 142201808 |
| Molecular Formula | C25H40ClNO6S2 |
| Molecular Weight | 550.18 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | (1R,3R,4S)-4-[(E,3S)-5-(4-chloro-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]cyclopentane-1,3-diol;(Z)-N-ethylsulfonyloct-5-enamide |
| SMILES | CC/C=C\CCCC(=O)NS(=O)(=O)CC.Cc1sc(CC[C@H](O)/C=C/[C@@H]2C[C@@H](O)C[C@H]2O)cc1Cl |
| InChI | InChI=1S/C15H21ClO3S.C10H19NO3S/c1-9-14(16)8-13(20-9)5-4-11(17)3-2-10-6-12(18)7-15(10)19;1-3-5-6-7-8-9-10(12)11-15(13,14)4-2/h2-3,8,10-12,15,17-19H,4-7H2,1H3;5-6H,3-4,7-9H2,1-2H3,(H,11,12)/b3-2+;6-5-/t10-,11-,12-,15-;/m1./s1 |
| InChIKey | LIJDWJPMBWHYLS-IRYFJVESSA-N |
| XLogP | 4.28 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.18 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|