C50H70B2Br2O8S2 — CID 162303738
CID 162303738 (PubChem CID 162303738) has the molecular formula C50H70B2Br2O8S2 and a molecular weight of 1044.67 g/mol.
| Compound Name | CID 162303738 |
|---|---|
| PubChem CID | 162303738 |
| Molecular Formula | C50H70B2Br2O8S2 |
| Molecular Weight | 1044.67 g/mol |
| Exact Mass | 1042.31 |
| IUPAC Name | — |
| SMILES | [B]=C[C@@H]1CC(O)[C@H](C/C=C\CCCC(=O)O)[C@H]1/C=C/[C@@H](O)CCc1sc(C)c(Br)c1CC.[B]=C[C@@H]1CC(O)[C@H](C/C=C\CCCC(=O)O)[C@H]1/C=C/[C@H](CC(C)c1cc(Br)c(C)s1)OC |
| InChI | InChI=1S/2C25H35BBrO4S/c1-16(24-14-22(27)17(2)32-24)12-19(31-3)10-11-20-18(15-26)13-23(28)21(20)8-6-4-5-7-9-25(29)30;1-3-19-23(32-16(2)25(19)27)13-11-18(28)10-12-20-17(15-26)14-22(29)21(20)8-6-4-5-7-9-24(30)31/h4,6,10-11,14-16,18-21,23,28H,5,7-9,12-13H2,1-3H3,(H,29,30);4,6,10,12,15,17-18,20-22,28-29H,3,5,7-9,11,13-14H2,1-2H3,(H,30,31)/b6-4-,11-10+;6-4-,12-10+/t16?,18-,19+,20-,21+,23?;17-,18+,20-,21+,22?/m00/s1 |
| InChIKey | HWEFDFSQEGFICD-GBCBYJJKSA-N |
| XLogP | 10.69 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1044.67 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|