C27H35NO6 — CID 126603929
(2,5-dioxopyrrolidin-1-yl) (Z)-7-[(1R,2S,5R)-2-hydroxy-5-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 126603929) has the molecular formula C27H35NO6 and a molecular weight of 469.58 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (Z)-7-[(1R,2S,5R)-2-hydroxy-5-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (Z)-7-[(1R,2S,5R)-2-hydroxy-5-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 126603929 |
| Molecular Formula | C27H35NO6 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (Z)-7-[(1R,2S,5R)-2-hydroxy-5-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | O=C(CCC/C=C\C[C@H]1[C@@H](O)CC[C@@H]1/C=C/[C@@H](O)CCc1ccccc1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C27H35NO6/c29-22(15-12-20-8-4-3-5-9-20)16-13-21-14-17-24(30)23(21)10-6-1-2-7-11-27(33)34-28-25(31)18-19-26(28)32/h1,3-6,8-9,13,16,21-24,29-30H,2,7,10-12,14-15,17-19H2/b6-1-,16-13+/t21-,22-,23+,24-/m0/s1 |
| InChIKey | USMZBZNTGWTURX-RTCRCRLWSA-N |
| XLogP | 3.65 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|