C30H39NO4S — CID 70535341
(Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-[[4-(4-methylphenyl)phenyl]methoxy]-2-thiomorpholin-4-ylcyclopentyl]hept-4-enoic acid (PubChem CID 70535341) has the molecular formula C30H39NO4S and a molecular weight of 509.71 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-[[4-(4-methylphenyl)phenyl]methoxy]-2-thiomorpholin-4-ylcyclopentyl]hept-4-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-[[4-(4-methylphenyl)phenyl]methoxy]-2-thiomorpholin-4-ylcyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 70535341 |
| Molecular Formula | C30H39NO4S |
| Molecular Weight | 509.71 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-[[4-(4-methylphenyl)phenyl]methoxy]-2-thiomorpholin-4-ylcyclopentyl]hept-4-enoic acid |
| SMILES | Cc1ccc(-c2ccc(CO[C@H]3C[C@@H](O)[C@H](N4CCSCC4)[C@H]3CC/C=C\CCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H39NO4S/c1-22-8-12-24(13-9-22)25-14-10-23(11-15-25)21-35-28-20-27(32)30(31-16-18-36-19-17-31)26(28)6-4-2-3-5-7-29(33)34/h2-3,8-15,26-28,30,32H,4-7,16-21H2,1H3,(H,33,34)/b3-2-/t26-,27+,28-,30+/m0/s1 |
| InChIKey | ATHIDPMTSCVMTA-HRCFBZQBSA-N |
| XLogP | 5.55 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.71 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|