C32H43NO5S — CID 70503437
methylsulfanylmethyl (E)-7-[(2R,3S,5S)-3-hydroxy-5-[[4-(4-methylphenyl)phenyl]methoxy]-2-morpholin-4-ylcyclopentyl]hept-4-enoate (PubChem CID 70503437) has the molecular formula C32H43NO5S and a molecular weight of 553.77 g/mol. Its IUPAC name is methylsulfanylmethyl (E)-7-[(2R,3S,5S)-3-hydroxy-5-[[4-(4-methylphenyl)phenyl]methoxy]-2-morpholin-4-ylcyclopentyl]hept-4-enoate.
| Compound Name | methylsulfanylmethyl (E)-7-[(2R,3S,5S)-3-hydroxy-5-[[4-(4-methylphenyl)phenyl]methoxy]-2-morpholin-4-ylcyclopentyl]hept-4-enoate |
|---|---|
| PubChem CID | 70503437 |
| Molecular Formula | C32H43NO5S |
| Molecular Weight | 553.77 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | methylsulfanylmethyl (E)-7-[(2R,3S,5S)-3-hydroxy-5-[[4-(4-methylphenyl)phenyl]methoxy]-2-morpholin-4-ylcyclopentyl]hept-4-enoate |
| SMILES | CSCOC(=O)CC/C=C/CCC1[C@@H](OCc2ccc(-c3ccc(C)cc3)cc2)C[C@H](O)[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C32H43NO5S/c1-24-9-13-26(14-10-24)27-15-11-25(12-16-27)22-37-30-21-29(34)32(33-17-19-36-20-18-33)28(30)7-5-3-4-6-8-31(35)38-23-39-2/h3-4,9-16,28-30,32,34H,5-8,17-23H2,1-2H3/b4-3+/t28?,29-,30-,32+/m0/s1 |
| InChIKey | RBPIDGSXKWPNGO-CHIYRDCNSA-N |
| XLogP | 5.61 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.77 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|