C26H33NO3S — CID 22821126
3-[(1S,2S,3S,5R)-5-[(4-benzylphenyl)methoxy]-3-hydroxy-2-thiomorpholin-4-ylcyclopentyl]propanal (PubChem CID 22821126) has the molecular formula C26H33NO3S and a molecular weight of 439.62 g/mol. Its IUPAC name is 3-[(1S,2S,3S,5R)-5-[(4-benzylphenyl)methoxy]-3-hydroxy-2-thiomorpholin-4-ylcyclopentyl]propanal.
| Compound Name | 3-[(1S,2S,3S,5R)-5-[(4-benzylphenyl)methoxy]-3-hydroxy-2-thiomorpholin-4-ylcyclopentyl]propanal |
|---|---|
| PubChem CID | 22821126 |
| Molecular Formula | C26H33NO3S |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 3-[(1S,2S,3S,5R)-5-[(4-benzylphenyl)methoxy]-3-hydroxy-2-thiomorpholin-4-ylcyclopentyl]propanal |
| SMILES | O=CCC[C@H]1[C@H](N2CCSCC2)[C@@H](O)C[C@H]1OCc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C26H33NO3S/c28-14-4-7-23-25(18-24(29)26(23)27-12-15-31-16-13-27)30-19-22-10-8-21(9-11-22)17-20-5-2-1-3-6-20/h1-3,5-6,8-11,14,23-26,29H,4,7,12-13,15-19H2/t23-,24+,25-,26+/m1/s1 |
| InChIKey | TWTFWIONGLEVEM-ZJSPYRCASA-N |
| XLogP | 3.94 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|