C29H39NO5S — CID 70550130
4-[(1R,2R,3S,5R)-2-(3-methoxyprop-2-enyl)-5-(oxan-2-yloxy)-3-[(5-phenylthiophen-3-yl)methoxy]cyclopentyl]morpholine (PubChem CID 70550130) has the molecular formula C29H39NO5S and a molecular weight of 513.70 g/mol. Its IUPAC name is 4-[(1R,2R,3S,5R)-2-(3-methoxyprop-2-enyl)-5-(oxan-2-yloxy)-3-[(5-phenylthiophen-3-yl)methoxy]cyclopentyl]morpholine.
| Compound Name | 4-[(1R,2R,3S,5R)-2-(3-methoxyprop-2-enyl)-5-(oxan-2-yloxy)-3-[(5-phenylthiophen-3-yl)methoxy]cyclopentyl]morpholine |
|---|---|
| PubChem CID | 70550130 |
| Molecular Formula | C29H39NO5S |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | 4-[(1R,2R,3S,5R)-2-(3-methoxyprop-2-enyl)-5-(oxan-2-yloxy)-3-[(5-phenylthiophen-3-yl)methoxy]cyclopentyl]morpholine |
| SMILES | COC=CC[C@@H]1[C@@H](N2CCOCC2)[C@H](OC2CCCCO2)C[C@@H]1OCc1csc(-c2ccccc2)c1 |
| InChI | InChI=1S/C29H39NO5S/c1-31-14-7-10-24-25(34-20-22-18-27(36-21-22)23-8-3-2-4-9-23)19-26(35-28-11-5-6-15-33-28)29(24)30-12-16-32-17-13-30/h2-4,7-9,14,18,21,24-26,28-29H,5-6,10-13,15-17,19-20H2,1H3/t24-,25-,26+,28?,29+/m0/s1 |
| InChIKey | IYAJNTFTXJNUHT-SUFDXHPRSA-N |
| XLogP | 5.48 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|