C14H26F2O — CID 129228274
4,4-difluoro-1-(3-methylcyclopentyl)octan-3-ol (PubChem CID 129228274) has the molecular formula C14H26F2O and a molecular weight of 248.36 g/mol. Its IUPAC name is 4,4-difluoro-1-(3-methylcyclopentyl)octan-3-ol.
| Compound Name | 4,4-difluoro-1-(3-methylcyclopentyl)octan-3-ol |
|---|---|
| PubChem CID | 129228274 |
| Molecular Formula | C14H26F2O |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 4,4-difluoro-1-(3-methylcyclopentyl)octan-3-ol |
| SMILES | CCCCC(F)(F)C(O)CCC1CCC(C)C1 |
| InChI | InChI=1S/C14H26F2O/c1-3-4-9-14(15,16)13(17)8-7-12-6-5-11(2)10-12/h11-13,17H,3-10H2,1-2H3 |
| InChIKey | CXANLKGMOHQIEN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |