C13H17F11O — CID 154715377
(2S)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)octan-1-ol (PubChem CID 154715377) has the molecular formula C13H17F11O and a molecular weight of 398.26 g/mol. Its IUPAC name is (2S)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)octan-1-ol.
| Compound Name | (2S)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)octan-1-ol |
|---|---|
| PubChem CID | 154715377 |
| Molecular Formula | C13H17F11O |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (2S)-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)octan-1-ol |
| SMILES | CCCCCC[C@@H](CO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H17F11O/c1-2-3-4-5-6-8(7-25)9(14,15)10(16,17)11(18,19)12(20,21)13(22,23)24/h8,25H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | JBWCMAKYQHESTE-QMMMGPOBSA-N |
| XLogP | 5.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|