C15H32O2Sn — CID 86584271
cis-(1R,2S)-2-(hydroxymethyl)cyclohexan-1-ol;dibutyltin (PubChem CID 86584271) has the molecular formula C15H32O2Sn and a molecular weight of 363.13 g/mol. Its IUPAC name is cis-(1R,2S)-2-(hydroxymethyl)cyclohexan-1-ol;dibutyltin.
| Compound Name | cis-(1R,2S)-2-(hydroxymethyl)cyclohexan-1-ol;dibutyltin |
|---|---|
| PubChem CID | 86584271 |
| Molecular Formula | C15H32O2Sn |
| Molecular Weight | 363.13 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | cis-(1R,2S)-2-(hydroxymethyl)cyclohexan-1-ol;dibutyltin |
| SMILES | CCCC[Sn]CCCC.OC[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C7H14O2.2C4H9.Sn/c8-5-6-3-1-2-4-7(6)9;2*1-3-4-2;/h6-9H,1-5H2;2*1,3-4H2,2H3;/t6-,7+;;;/m0.../s1 |
| InChIKey | YYQMTNLESQIQAD-PXJNTPRPSA-N |
| XLogP | 3.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.13 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|