About cyclohexyl 2-hydroxyethanedithioate;dibutyltin
cyclohexyl 2-hydroxyethanedithioate;dibutyltin (PubChem CID 88780816) has the molecular formula C16H32OS2Sn
and a molecular weight of 423.28 g/mol. Its IUPAC name is cyclohexyl 2-hydroxyethanedithioate;dibutyltin.
Molecular Properties
| Compound Name | cyclohexyl 2-hydroxyethanedithioate;dibutyltin |
| PubChem CID | 88780816 |
| Molecular Formula | C16H32OS2Sn |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | cyclohexyl 2-hydroxyethanedithioate;dibutyltin |
| SMILES | CCCC[Sn]CCCC.OCC(=S)SC1CCCCC1 |
| InChI | InChI=1S/C8H14OS2.2C4H9.Sn/c9-6-8(10)11-7-4-2-1-3-5-7;2*1-3-4-2;/h7,9H,1-6H2;2*1,3-4H2,2H3; |
| InChIKey | BVJFUSBQMMMKMG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl 2-hydroxyethanedithioate;dibutyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-hydroxyethanedithioate;dibutyltin?
The IUPAC name of cyclohexyl 2-hydroxyethanedithioate;dibutyltin (CID 88780816) is cyclohexyl 2-hydroxyethanedithioate;dibutyltin.
What is the SMILES notation for cyclohexyl 2-hydroxyethanedithioate;dibutyltin?
The canonical SMILES for cyclohexyl 2-hydroxyethanedithioate;dibutyltin is CCCC[Sn]CCCC.OCC(=S)SC1CCCCC1.
What is the InChIKey of cyclohexyl 2-hydroxyethanedithioate;dibutyltin?
The InChIKey is BVJFUSBQMMMKMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14OS2.2C4H9.Sn/c9-6-8(10)11-7-4-2-1-3-5-7;2*1-3-4-2;/h7,9H,1-6H2;2*1,3-4H2,2H3;.
What are the key properties of cyclohexyl 2-hydroxyethanedithioate;dibutyltin?
cyclohexyl 2-hydroxyethanedithioate;dibutyltin has a molecular weight of 423.28 g/mol, XLogP of 5.50, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-hydroxyethanedithioate;dibutyltin is sourced from PubChem (CID 88780816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).