C14H23NO5S2 — CID 88779905
(2S)-8-acetylsulfanyl-7-(acetylsulfanylmethyl)-2-amino-4-methyl-6-oxooctanoic acid (PubChem CID 88779905) has the molecular formula C14H23NO5S2 and a molecular weight of 349.47 g/mol. Its IUPAC name is (2S)-8-acetylsulfanyl-7-(acetylsulfanylmethyl)-2-amino-4-methyl-6-oxooctanoic acid.
| Compound Name | (2S)-8-acetylsulfanyl-7-(acetylsulfanylmethyl)-2-amino-4-methyl-6-oxooctanoic acid |
|---|---|
| PubChem CID | 88779905 |
| Molecular Formula | C14H23NO5S2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (2S)-8-acetylsulfanyl-7-(acetylsulfanylmethyl)-2-amino-4-methyl-6-oxooctanoic acid |
| SMILES | CC(=O)SCC(CSC(C)=O)C(=O)CC(C)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C14H23NO5S2/c1-8(4-12(15)14(19)20)5-13(18)11(6-21-9(2)16)7-22-10(3)17/h8,11-12H,4-7,15H2,1-3H3,(H,19,20)/t8?,12-/m0/s1 |
| InChIKey | TYJSSOACEDEIEX-MYIOLCAUSA-N |
| XLogP | 1.56 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|