About 2-[4-(dimethylamino)phenyl]ethanol;S-[2-[4-(dimethylamino)phenyl]ethyl] ethanethioate
2-[4-(dimethylamino)phenyl]ethanol;S-[2-[4-(dimethylamino)phenyl]ethyl] ethanethioate (PubChem CID 157206246) has the molecular formula C22H32N2O2S
and a molecular weight of 388.58 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]ethanol;S-[2-[4-(dimethylamino)phenyl]ethyl] ethanethioate.
Molecular Properties
| Compound Name | 2-[4-(dimethylamino)phenyl]ethanol;S-[2-[4-(dimethylamino)phenyl]ethyl] ethanethioate |
| PubChem CID | 157206246 |
| Molecular Formula | C22H32N2O2S |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]ethanol;S-[2-[4-(dimethylamino)phenyl]ethyl] ethanethioate |
| SMILES | CC(=O)SCCc1ccc(N(C)C)cc1.CN(C)c1ccc(CCO)cc1 |
| InChI | InChI=1S/C12H17NOS.C10H15NO/c1-10(14)15-9-8-11-4-6-12(7-5-11)13(2)3;1-11(2)10-5-3-9(4-6-10)7-8-12/h4-7H,8-9H2,1-3H3;3-6,12H,7-8H2,1-2H3 |
| InChIKey | ARJXBQFMEBWUPQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(dimethylamino)phenyl]ethanol;S-[2-[4-(dimethylamino)phenyl]ethyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(dimethylamino)phenyl]ethanol;S-[2-[4-(dimethylamino)phenyl]ethyl] ethanethioate?
The IUPAC name of 2-[4-(dimethylamino)phenyl]ethanol;S-[2-[4-(dimethylamino)phenyl]ethyl] ethanethioate (CID 157206246) is 2-[4-(dimethylamino)phenyl]ethanol;S-[2-[4-(dimethylamino)phenyl]ethyl] ethanethioate.
What is the SMILES notation for 2-[4-(dimethylamino)phenyl]ethanol;S-[2-[4-(dimethylamino)phenyl]ethyl] ethanethioate?
The canonical SMILES for 2-[4-(dimethylamino)phenyl]ethanol;S-[2-[4-(dimethylamino)phenyl]ethyl] ethanethioate is CC(=O)SCCc1ccc(N(C)C)cc1.CN(C)c1ccc(CCO)cc1.
What is the InChIKey of 2-[4-(dimethylamino)phenyl]ethanol;S-[2-[4-(dimethylamino)phenyl]ethyl] ethanethioate?
The InChIKey is ARJXBQFMEBWUPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NOS.C10H15NO/c1-10(14)15-9-8-11-4-6-12(7-5-11)13(2)3;1-11(2)10-5-3-9(4-6-10)7-8-12/h4-7H,8-9H2,1-3H3;3-6,12H,7-8H2,1-2H3.
What are the key properties of 2-[4-(dimethylamino)phenyl]ethanol;S-[2-[4-(dimethylamino)phenyl]ethyl] ethanethioate?
2-[4-(dimethylamino)phenyl]ethanol;S-[2-[4-(dimethylamino)phenyl]ethyl] ethanethioate has a molecular weight of 388.58 g/mol, XLogP of 3.86, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(dimethylamino)phenyl]ethanol;S-[2-[4-(dimethylamino)phenyl]ethyl] ethanethioate is sourced from PubChem (CID 157206246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).