C13H19NO4S — CID 54106599
4-(2,2,3-trimethylbutanoylamino)benzenesulfonic acid (PubChem CID 54106599) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is 4-(2,2,3-trimethylbutanoylamino)benzenesulfonic acid.
| Compound Name | 4-(2,2,3-trimethylbutanoylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 54106599 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 4-(2,2,3-trimethylbutanoylamino)benzenesulfonic acid |
| SMILES | CC(C)C(C)(C)C(=O)Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C13H19NO4S/c1-9(2)13(3,4)12(15)14-10-5-7-11(8-6-10)19(16,17)18/h5-9H,1-4H3,(H,14,15)(H,16,17,18) |
| InChIKey | PDRWTVHMOSVOKF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|