C15H12ClN3O3 — CID 4245956
N-(3-chlorophenyl)-N'-[(4-hydroxyphenyl)methylideneamino]oxamide (PubChem CID 4245956) has the molecular formula C15H12ClN3O3 and a molecular weight of 317.73 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N'-[(4-hydroxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(3-chlorophenyl)-N'-[(4-hydroxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 4245956 |
| Molecular Formula | C15H12ClN3O3 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-(3-chlorophenyl)-N'-[(4-hydroxyphenyl)methylideneamino]oxamide |
| SMILES | O=C(NN=Cc1ccc(O)cc1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H12ClN3O3/c16-11-2-1-3-12(8-11)18-14(21)15(22)19-17-9-10-4-6-13(20)7-5-10/h1-9,20H,(H,18,21)(H,19,22) |
| InChIKey | KDAOHCFYBUSDRL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|