C11H10Cl2FNO4 — CID 156838798
methyl 3-(3,5-dichloroanilino)-2-fluoro-2-methoxy-3-oxopropanoate (PubChem CID 156838798) has the molecular formula C11H10Cl2FNO4 and a molecular weight of 310.11 g/mol. Its IUPAC name is methyl 3-(3,5-dichloroanilino)-2-fluoro-2-methoxy-3-oxopropanoate.
| Compound Name | methyl 3-(3,5-dichloroanilino)-2-fluoro-2-methoxy-3-oxopropanoate |
|---|---|
| PubChem CID | 156838798 |
| Molecular Formula | C11H10Cl2FNO4 |
| Molecular Weight | 310.11 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | methyl 3-(3,5-dichloroanilino)-2-fluoro-2-methoxy-3-oxopropanoate |
| SMILES | COC(=O)C(F)(OC)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H10Cl2FNO4/c1-18-10(17)11(14,19-2)9(16)15-8-4-6(12)3-7(13)5-8/h3-5H,1-2H3,(H,15,16) |
| InChIKey | PYQWBYOEFWTFPZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.11 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|