C18H27ClFN5O — CID 142060008
N-[(E)-2-[(E)-2-[(2-amino-6-chloropyrimidin-4-yl)amino]prop-1-enyl]-3-methylpent-2-enyl]-3-fluoropropanamide;ethene (PubChem CID 142060008) has the molecular formula C18H27ClFN5O and a molecular weight of 383.90 g/mol. Its IUPAC name is N-[(E)-2-[(E)-2-[(2-amino-6-chloropyrimidin-4-yl)amino]prop-1-enyl]-3-methylpent-2-enyl]-3-fluoropropanamide;ethene.
| Compound Name | N-[(E)-2-[(E)-2-[(2-amino-6-chloropyrimidin-4-yl)amino]prop-1-enyl]-3-methylpent-2-enyl]-3-fluoropropanamide;ethene |
|---|---|
| PubChem CID | 142060008 |
| Molecular Formula | C18H27ClFN5O |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | N-[(E)-2-[(E)-2-[(2-amino-6-chloropyrimidin-4-yl)amino]prop-1-enyl]-3-methylpent-2-enyl]-3-fluoropropanamide;ethene |
| SMILES | C=C.CC/C(C)=C(\C=C(/C)Nc1cc(Cl)nc(N)n1)CNC(=O)CCF |
| InChI | InChI=1S/C16H23ClFN5O.C2H4/c1-4-10(2)12(9-20-15(24)5-6-18)7-11(3)21-14-8-13(17)22-16(19)23-14;1-2/h7-8H,4-6,9H2,1-3H3,(H,20,24)(H3,19,21,22,23);1-2H2/b11-7+,12-10+; |
| InChIKey | BSHVSWSPJSLUHI-OENMYPHOSA-N |
| XLogP | 4.03 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|