C10H13N5O2S — CID 106928791
[2-(ethoxymethyl)-6-(1,3-oxazol-2-ylsulfanyl)pyrimidin-4-yl]hydrazine (PubChem CID 106928791) has the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. Its IUPAC name is [2-(ethoxymethyl)-6-(1,3-oxazol-2-ylsulfanyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(ethoxymethyl)-6-(1,3-oxazol-2-ylsulfanyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 106928791 |
| Molecular Formula | C10H13N5O2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | [2-(ethoxymethyl)-6-(1,3-oxazol-2-ylsulfanyl)pyrimidin-4-yl]hydrazine |
| SMILES | CCOCc1nc(NN)cc(Sc2ncco2)n1 |
| InChI | InChI=1S/C10H13N5O2S/c1-2-16-6-8-13-7(15-11)5-9(14-8)18-10-12-3-4-17-10/h3-5H,2,6,11H2,1H3,(H,13,14,15) |
| InChIKey | QPYIFYSEGVWVFN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|