C11H14N6OS — CID 113402011
[2-(methoxymethyl)-6-(4-methylpyrimidin-2-yl)sulfanylpyrimidin-4-yl]hydrazine (PubChem CID 113402011) has the molecular formula C11H14N6OS and a molecular weight of 278.34 g/mol. Its IUPAC name is [2-(methoxymethyl)-6-(4-methylpyrimidin-2-yl)sulfanylpyrimidin-4-yl]hydrazine.
| Compound Name | [2-(methoxymethyl)-6-(4-methylpyrimidin-2-yl)sulfanylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 113402011 |
| Molecular Formula | C11H14N6OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | [2-(methoxymethyl)-6-(4-methylpyrimidin-2-yl)sulfanylpyrimidin-4-yl]hydrazine |
| SMILES | COCc1nc(NN)cc(Sc2nccc(C)n2)n1 |
| InChI | InChI=1S/C11H14N6OS/c1-7-3-4-13-11(14-7)19-10-5-8(17-12)15-9(16-10)6-18-2/h3-5H,6,12H2,1-2H3,(H,15,16,17) |
| InChIKey | NJIAJNSYINDOAI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|