C10H9F3N4S2 — CID 102721373
[6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-4-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 102721373) has the molecular formula C10H9F3N4S2 and a molecular weight of 306.34 g/mol. Its IUPAC name is [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-4-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102721373 |
| Molecular Formula | C10H9F3N4S2 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | [6-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | Cc1csc(Sc2cc(C(F)(F)F)cc(NN)n2)n1 |
| InChI | InChI=1S/C10H9F3N4S2/c1-5-4-18-9(15-5)19-8-3-6(10(11,12)13)2-7(16-8)17-14/h2-4H,14H2,1H3,(H,16,17) |
| InChIKey | ZMZXRJZCTVYSBR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|