C14H21F3N4 — CID 102720558
N-(2-ethylcyclohexyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102720558) has the molecular formula C14H21F3N4 and a molecular weight of 302.34 g/mol. Its IUPAC name is N-(2-ethylcyclohexyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-(2-ethylcyclohexyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102720558 |
| Molecular Formula | C14H21F3N4 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | N-(2-ethylcyclohexyl)-6-hydrazinyl-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCC1CCCCC1Nc1cc(C(F)(F)F)cc(NN)n1 |
| InChI | InChI=1S/C14H21F3N4/c1-2-9-5-3-4-6-11(9)19-12-7-10(14(15,16)17)8-13(20-12)21-18/h7-9,11H,2-6,18H2,1H3,(H2,19,20,21) |
| InChIKey | LNKNLHMYJAPEFN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|