C14H20F3N3O — CID 102718306
2-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]cyclohexan-1-ol (PubChem CID 102718306) has the molecular formula C14H20F3N3O and a molecular weight of 303.33 g/mol. Its IUPAC name is 2-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]cyclohexan-1-ol.
| Compound Name | 2-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102718306 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-[[6-(ethylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]cyclohexan-1-ol |
| SMILES | CCNc1cc(C(F)(F)F)cc(NC2CCCCC2O)n1 |
| InChI | InChI=1S/C14H20F3N3O/c1-2-18-12-7-9(14(15,16)17)8-13(20-12)19-10-5-3-4-6-11(10)21/h7-8,10-11,21H,2-6H2,1H3,(H2,18,19,20) |
| InChIKey | RYAWGJOHUPORAS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |