C13H16ClF3N2O — CID 102716139
2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]cycloheptan-1-ol (PubChem CID 102716139) has the molecular formula C13H16ClF3N2O and a molecular weight of 308.73 g/mol. Its IUPAC name is 2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]cycloheptan-1-ol.
| Compound Name | 2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]cycloheptan-1-ol |
|---|---|
| PubChem CID | 102716139 |
| Molecular Formula | C13H16ClF3N2O |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]cycloheptan-1-ol |
| SMILES | OC1CCCCCC1Nc1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C13H16ClF3N2O/c14-11-6-8(13(15,16)17)7-12(19-11)18-9-4-2-1-3-5-10(9)20/h6-7,9-10,20H,1-5H2,(H,18,19) |
| InChIKey | IDBPVHFNAJVFMC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|