C13H16ClF3N2O — CID 102716000
[2-[[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]methyl]cyclopentyl]methanol (PubChem CID 102716000) has the molecular formula C13H16ClF3N2O and a molecular weight of 308.73 g/mol. Its IUPAC name is [2-[[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]methyl]cyclopentyl]methanol.
| Compound Name | [2-[[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]methyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 102716000 |
| Molecular Formula | C13H16ClF3N2O |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | [2-[[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]methyl]cyclopentyl]methanol |
| SMILES | OCC1CCCC1CNc1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C13H16ClF3N2O/c14-11-4-10(13(15,16)17)5-12(19-11)18-6-8-2-1-3-9(8)7-20/h4-5,8-9,20H,1-3,6-7H2,(H,18,19) |
| InChIKey | XYQVHZVPJXEOCL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|