C12H13ClF3N3O — CID 102716189
N-[2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 102716189) has the molecular formula C12H13ClF3N3O and a molecular weight of 307.70 g/mol. Its IUPAC name is N-[2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 102716189 |
| Molecular Formula | C12H13ClF3N3O |
| Molecular Weight | 307.70 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | N-[2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | O=C(NCCNc1cc(C(F)(F)F)cc(Cl)n1)C1CC1 |
| InChI | InChI=1S/C12H13ClF3N3O/c13-9-5-8(12(14,15)16)6-10(19-9)17-3-4-18-11(20)7-1-2-7/h5-7H,1-4H2,(H,17,19)(H,18,20) |
| InChIKey | UUMGSBDXSDFDCL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|