C13H17ClF3N3 — CID 102716115
6-chloro-N-(2,6-dimethylpiperidin-1-yl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102716115) has the molecular formula C13H17ClF3N3 and a molecular weight of 307.75 g/mol. Its IUPAC name is 6-chloro-N-(2,6-dimethylpiperidin-1-yl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(2,6-dimethylpiperidin-1-yl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102716115 |
| Molecular Formula | C13H17ClF3N3 |
| Molecular Weight | 307.75 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 6-chloro-N-(2,6-dimethylpiperidin-1-yl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC1CCCC(C)N1Nc1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C13H17ClF3N3/c1-8-4-3-5-9(2)20(8)19-12-7-10(13(15,16)17)6-11(14)18-12/h6-9H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | USKNXNWZYJODAA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.75 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|