C13H18F3N3O — CID 102718792
2-[[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]methyl]cyclopentan-1-ol (PubChem CID 102718792) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-[[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]methyl]cyclopentan-1-ol.
| Compound Name | 2-[[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 102718792 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-[[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]methyl]cyclopentan-1-ol |
| SMILES | CNc1cc(C(F)(F)F)cc(NCC2CCCC2O)n1 |
| InChI | InChI=1S/C13H18F3N3O/c1-17-11-5-9(13(14,15)16)6-12(19-11)18-7-8-3-2-4-10(8)20/h5-6,8,10,20H,2-4,7H2,1H3,(H2,17,18,19) |
| InChIKey | HJRHTPDMFGQTEN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |