About 2-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol
2-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol (PubChem CID 102719042) has the molecular formula C11H16F3N3O2
and a molecular weight of 279.26 g/mol. Its IUPAC name is 2-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol |
| PubChem CID | 102719042 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol |
| SMILES | CNc1cc(C(F)(F)F)cc(NC(C)(CO)CO)n1 |
| InChI | InChI=1S/C11H16F3N3O2/c1-10(5-18,6-19)17-9-4-7(11(12,13)14)3-8(15-2)16-9/h3-4,18-19H,5-6H2,1-2H3,(H2,15,16,17) |
| InChIKey | YQOJNYLVDLMDPS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol?
The IUPAC name of 2-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol (CID 102719042) is 2-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol.
What is the SMILES notation for 2-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol?
The canonical SMILES for 2-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol is CNc1cc(C(F)(F)F)cc(NC(C)(CO)CO)n1.
What is the InChIKey of 2-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol?
The InChIKey is YQOJNYLVDLMDPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N3O2/c1-10(5-18,6-19)17-9-4-7(11(12,13)14)3-8(15-2)16-9/h3-4,18-19H,5-6H2,1-2H3,(H2,15,16,17).
What are the key properties of 2-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol?
2-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol has a molecular weight of 279.26 g/mol, XLogP of 1.30, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]propane-1,3-diol is sourced from PubChem (CID 102719042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).