C10H15F3N4O2S — CID 106343111
N-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]ethanesulfonamide (PubChem CID 106343111) has the molecular formula C10H15F3N4O2S and a molecular weight of 312.32 g/mol. Its IUPAC name is N-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]ethanesulfonamide.
| Compound Name | N-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]ethanesulfonamide |
|---|---|
| PubChem CID | 106343111 |
| Molecular Formula | C10H15F3N4O2S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-methyl-2-[[6-(methylamino)-4-(trifluoromethyl)-2-pyridinyl]amino]ethanesulfonamide |
| SMILES | CNc1cc(C(F)(F)F)cc(NCCS(=O)(=O)NC)n1 |
| InChI | InChI=1S/C10H15F3N4O2S/c1-14-8-5-7(10(11,12)13)6-9(17-8)16-3-4-20(18,19)15-2/h5-6,15H,3-4H2,1-2H3,(H2,14,16,17) |
| InChIKey | TUAABYQKNXVODM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |