C8H13ClN4O2S — CID 106341549
2-[(2-chloro-6-methylpyrimidin-4-yl)amino]-N-methylethanesulfonamide (PubChem CID 106341549) has the molecular formula C8H13ClN4O2S and a molecular weight of 264.74 g/mol. Its IUPAC name is 2-[(2-chloro-6-methylpyrimidin-4-yl)amino]-N-methylethanesulfonamide.
| Compound Name | 2-[(2-chloro-6-methylpyrimidin-4-yl)amino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 106341549 |
| Molecular Formula | C8H13ClN4O2S |
| Molecular Weight | 264.74 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-[(2-chloro-6-methylpyrimidin-4-yl)amino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNc1cc(C)nc(Cl)n1 |
| InChI | InChI=1S/C8H13ClN4O2S/c1-6-5-7(13-8(9)12-6)11-3-4-16(14,15)10-2/h5,10H,3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | SQISVJBDVHPBKJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.74 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |