C15H32ClN3O — CID 142930051
2-[(2-chloro-6-methylpyrimidin-4-yl)amino]ethanol;ethane;2-methylpropane (PubChem CID 142930051) has the molecular formula C15H32ClN3O and a molecular weight of 305.89 g/mol. Its IUPAC name is 2-[(2-chloro-6-methylpyrimidin-4-yl)amino]ethanol;ethane;2-methylpropane.
| Compound Name | 2-[(2-chloro-6-methylpyrimidin-4-yl)amino]ethanol;ethane;2-methylpropane |
|---|---|
| PubChem CID | 142930051 |
| Molecular Formula | C15H32ClN3O |
| Molecular Weight | 305.89 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 2-[(2-chloro-6-methylpyrimidin-4-yl)amino]ethanol;ethane;2-methylpropane |
| SMILES | CC.CC.CC(C)C.Cc1cc(NCCO)nc(Cl)n1 |
| InChI | InChI=1S/C7H10ClN3O.C4H10.2C2H6/c1-5-4-6(9-2-3-12)11-7(8)10-5;1-4(2)3;2*1-2/h4,12H,2-3H2,1H3,(H,9,10,11);4H,1-3H3;2*1-2H3 |
| InChIKey | YFXZOEMTAHIKDO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |