C9H13ClN4O — CID 62482794
4-[(2-chloro-6-methylpyrimidin-4-yl)amino]butanamide (PubChem CID 62482794) has the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. Its IUPAC name is 4-[(2-chloro-6-methylpyrimidin-4-yl)amino]butanamide.
| Compound Name | 4-[(2-chloro-6-methylpyrimidin-4-yl)amino]butanamide |
|---|---|
| PubChem CID | 62482794 |
| Molecular Formula | C9H13ClN4O |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 4-[(2-chloro-6-methylpyrimidin-4-yl)amino]butanamide |
| SMILES | Cc1cc(NCCCC(N)=O)nc(Cl)n1 |
| InChI | InChI=1S/C9H13ClN4O/c1-6-5-8(14-9(10)13-6)12-4-2-3-7(11)15/h5H,2-4H2,1H3,(H2,11,15)(H,12,13,14) |
| InChIKey | YPTQDMIQNGHEDR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|