C18H14FN5O5 — CID 22535593
4-fluoro-N'-[6-(2-methoxyphenoxy)-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 22535593) has the molecular formula C18H14FN5O5 and a molecular weight of 399.34 g/mol. Its IUPAC name is 4-fluoro-N'-[6-(2-methoxyphenoxy)-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 4-fluoro-N'-[6-(2-methoxyphenoxy)-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22535593 |
| Molecular Formula | C18H14FN5O5 |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 4-fluoro-N'-[6-(2-methoxyphenoxy)-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | COc1ccccc1Oc1ncnc(NNC(=O)c2ccc(F)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14FN5O5/c1-28-13-4-2-3-5-14(13)29-18-15(24(26)27)16(20-10-21-18)22-23-17(25)11-6-8-12(19)9-7-11/h2-10H,1H3,(H,23,25)(H,20,21,22) |
| InChIKey | GWSFVUQDIBQURI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|