C18H15FN6O3 — CID 23488172
N'-[6-(benzylamino)-5-nitropyrimidin-4-yl]-4-fluorobenzohydrazide (PubChem CID 23488172) has the molecular formula C18H15FN6O3 and a molecular weight of 382.36 g/mol. Its IUPAC name is N'-[6-(benzylamino)-5-nitropyrimidin-4-yl]-4-fluorobenzohydrazide.
| Compound Name | N'-[6-(benzylamino)-5-nitropyrimidin-4-yl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 23488172 |
| Molecular Formula | C18H15FN6O3 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N'-[6-(benzylamino)-5-nitropyrimidin-4-yl]-4-fluorobenzohydrazide |
| SMILES | O=C(NNc1ncnc(NCc2ccccc2)c1[N+](=O)[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FN6O3/c19-14-8-6-13(7-9-14)18(26)24-23-17-15(25(27)28)16(21-11-22-17)20-10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H,24,26)(H2,20,21,22,23) |
| InChIKey | DQXPFHSTWZCDEC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|