C14H13FN6O3 — CID 23487976
4-fluoro-N'-[5-nitro-6-(prop-2-enylamino)pyrimidin-4-yl]benzohydrazide (PubChem CID 23487976) has the molecular formula C14H13FN6O3 and a molecular weight of 332.30 g/mol. Its IUPAC name is 4-fluoro-N'-[5-nitro-6-(prop-2-enylamino)pyrimidin-4-yl]benzohydrazide.
| Compound Name | 4-fluoro-N'-[5-nitro-6-(prop-2-enylamino)pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23487976 |
| Molecular Formula | C14H13FN6O3 |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 4-fluoro-N'-[5-nitro-6-(prop-2-enylamino)pyrimidin-4-yl]benzohydrazide |
| SMILES | C=CCNc1ncnc(NNC(=O)c2ccc(F)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13FN6O3/c1-2-7-16-12-11(21(23)24)13(18-8-17-12)19-20-14(22)9-3-5-10(15)6-4-9/h2-6,8H,1,7H2,(H,20,22)(H2,16,17,18,19) |
| InChIKey | AYLLRDAKGFBCAM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|