C8H7ClN6O2 — CID 106195263
2-chloro-N-(1H-imidazol-2-ylmethyl)-5-nitropyrimidin-4-amine (PubChem CID 106195263) has the molecular formula C8H7ClN6O2 and a molecular weight of 254.64 g/mol. Its IUPAC name is 2-chloro-N-(1H-imidazol-2-ylmethyl)-5-nitropyrimidin-4-amine.
| Compound Name | 2-chloro-N-(1H-imidazol-2-ylmethyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 106195263 |
| Molecular Formula | C8H7ClN6O2 |
| Molecular Weight | 254.64 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-chloro-N-(1H-imidazol-2-ylmethyl)-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1cnc(Cl)nc1NCc1ncc[nH]1 |
| InChI | InChI=1S/C8H7ClN6O2/c9-8-13-3-5(15(16)17)7(14-8)12-4-6-10-1-2-11-6/h1-3H,4H2,(H,10,11)(H,12,13,14) |
| InChIKey | DNAPKKNMWZSHOH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.64 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|