About tert-butyl 4-iodopyrazole-1-carboxylate;4-iodo-2H-pyrrole
tert-butyl 4-iodopyrazole-1-carboxylate;4-iodo-2H-pyrrole (PubChem CID 158312194) has the molecular formula C12H15I2N3O2
and a molecular weight of 487.08 g/mol. Its IUPAC name is tert-butyl 4-iodopyrazole-1-carboxylate;4-iodo-2H-pyrrole.
Molecular Properties
| Compound Name | tert-butyl 4-iodopyrazole-1-carboxylate;4-iodo-2H-pyrrole |
| PubChem CID | 158312194 |
| Molecular Formula | C12H15I2N3O2 |
| Molecular Weight | 487.08 g/mol |
| Exact Mass | 486.93 |
| IUPAC Name | tert-butyl 4-iodopyrazole-1-carboxylate;4-iodo-2H-pyrrole |
| SMILES | CC(C)(C)OC(=O)n1cc(I)cn1.IC1=CCN=C1 |
| InChI | InChI=1S/C8H11IN2O2.C4H4IN/c1-8(2,3)13-7(12)11-5-6(9)4-10-11;5-4-1-2-6-3-4/h4-5H,1-3H3;1,3H,2H2 |
| InChIKey | GNUUJOZBWZUIHM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.08 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-iodopyrazole-1-carboxylate;4-iodo-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-iodopyrazole-1-carboxylate;4-iodo-2H-pyrrole?
The IUPAC name of tert-butyl 4-iodopyrazole-1-carboxylate;4-iodo-2H-pyrrole (CID 158312194) is tert-butyl 4-iodopyrazole-1-carboxylate;4-iodo-2H-pyrrole.
What is the SMILES notation for tert-butyl 4-iodopyrazole-1-carboxylate;4-iodo-2H-pyrrole?
The canonical SMILES for tert-butyl 4-iodopyrazole-1-carboxylate;4-iodo-2H-pyrrole is CC(C)(C)OC(=O)n1cc(I)cn1.IC1=CCN=C1.
What is the InChIKey of tert-butyl 4-iodopyrazole-1-carboxylate;4-iodo-2H-pyrrole?
The InChIKey is GNUUJOZBWZUIHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11IN2O2.C4H4IN/c1-8(2,3)13-7(12)11-5-6(9)4-10-11;5-4-1-2-6-3-4/h4-5H,1-3H3;1,3H,2H2.
What are the key properties of tert-butyl 4-iodopyrazole-1-carboxylate;4-iodo-2H-pyrrole?
tert-butyl 4-iodopyrazole-1-carboxylate;4-iodo-2H-pyrrole has a molecular weight of 487.08 g/mol, XLogP of 3.66, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-iodopyrazole-1-carboxylate;4-iodo-2H-pyrrole is sourced from PubChem (CID 158312194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).