C14H16N2O3S — CID 90729528
tert-butyl 4-(5-acetylthiophen-3-yl)pyrazole-1-carboxylate (PubChem CID 90729528) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is tert-butyl 4-(5-acetylthiophen-3-yl)pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-(5-acetylthiophen-3-yl)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 90729528 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | tert-butyl 4-(5-acetylthiophen-3-yl)pyrazole-1-carboxylate |
| SMILES | CC(=O)c1cc(-c2cnn(C(=O)OC(C)(C)C)c2)cs1 |
| InChI | InChI=1S/C14H16N2O3S/c1-9(17)12-5-10(8-20-12)11-6-15-16(7-11)13(18)19-14(2,3)4/h5-8H,1-4H3 |
| InChIKey | LSFVEBFYOFMRKX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |