C21H36BN3O4 — CID 168946156
tert-butyl 3-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidin-1-yl]propanoate (PubChem CID 168946156) has the molecular formula C21H36BN3O4 and a molecular weight of 405.35 g/mol. Its IUPAC name is tert-butyl 3-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidin-1-yl]propanoate.
| Compound Name | tert-butyl 3-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidin-1-yl]propanoate |
|---|---|
| PubChem CID | 168946156 |
| Molecular Formula | C21H36BN3O4 |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | tert-butyl 3-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidin-1-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCN1CCCC(n2cc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C21H36BN3O4/c1-19(2,3)27-18(26)10-12-24-11-8-9-17(15-24)25-14-16(13-23-25)22-28-20(4,5)21(6,7)29-22/h13-14,17H,8-12,15H2,1-7H3 |
| InChIKey | JAIXZCJAXDMOGG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|