C10H11N3O2S — CID 155230614
5-(1-methylazetidin-3-yl)sulfonylpyridine-2-carbonitrile (PubChem CID 155230614) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 5-(1-methylazetidin-3-yl)sulfonylpyridine-2-carbonitrile.
| Compound Name | 5-(1-methylazetidin-3-yl)sulfonylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 155230614 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 5-(1-methylazetidin-3-yl)sulfonylpyridine-2-carbonitrile |
| SMILES | CN1CC(S(=O)(=O)c2ccc(C#N)nc2)C1 |
| InChI | InChI=1S/C10H11N3O2S/c1-13-6-10(7-13)16(14,15)9-3-2-8(4-11)12-5-9/h2-3,5,10H,6-7H2,1H3 |
| InChIKey | LORUNGGGIKAGMS-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |